C9H9FO3 — CID 174331535
methyl 2-fluoro-6-formylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 174331535) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is methyl 2-fluoro-6-formylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 2-fluoro-6-formylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 174331535 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | methyl 2-fluoro-6-formylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(F)CCC=C1C=O |
| InChI | InChI=1S/C9H9FO3/c1-13-9(12)8-6(5-11)3-2-4-7(8)10/h3,5H,2,4H2,1H3 |
| InChIKey | WYBRJNYIVIORCN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|