C9H13NO — CID 123224865
(4Z)-4-(ethylideneamino)-2-methylhexa-1,4-dien-3-one (PubChem CID 123224865) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4Z)-4-(ethylideneamino)-2-methylhexa-1,4-dien-3-one.
| Compound Name | (4Z)-4-(ethylideneamino)-2-methylhexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 123224865 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4Z)-4-(ethylideneamino)-2-methylhexa-1,4-dien-3-one |
| SMILES | C=C(C)C(=O)C(=C/C)/N=C/C |
| InChI | InChI=1S/C9H13NO/c1-5-8(10-6-2)9(11)7(3)4/h5-6H,3H2,1-2,4H3/b8-5-,10-6+ |
| InChIKey | ZZIDOWRIWPUYGD-YBMVAOSUSA-N |
| XLogP | 2.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|