C28H21IN2O8 — CID 123225855
4-ethyl-3-iodo-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-ethyl-3-(2-phenylethynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 123225855) has the molecular formula C28H21IN2O8 and a molecular weight of 640.39 g/mol. Its IUPAC name is 4-ethyl-3-iodo-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-ethyl-3-(2-phenylethynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-ethyl-3-iodo-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-ethyl-3-(2-phenylethynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 123225855 |
| Molecular Formula | C28H21IN2O8 |
| Molecular Weight | 640.39 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | 4-ethyl-3-iodo-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-ethyl-3-(2-phenylethynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCc1c2c(oc(=O)c1C#Cc1ccccc1)CC(=O)NC2=O.CCc1c2c(oc(=O)c1I)CC(=O)NC2=O |
| InChI | InChI=1S/C18H13NO4.C10H8INO4/c1-2-12-13(9-8-11-6-4-3-5-7-11)18(22)23-14-10-15(20)19-17(21)16(12)14;1-2-4-7-5(16-10(15)8(4)11)3-6(13)12-9(7)14/h3-7H,2,10H2,1H3,(H,19,20,21);2-3H2,1H3,(H,12,13,14) |
| InChIKey | OUJXHEHPWQLZTP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|