C23H18N2O7 — CID 123475788
4-hydroxy-3H-pyridine-2,6-dione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 123475788) has the molecular formula C23H18N2O7 and a molecular weight of 434.40 g/mol. Its IUPAC name is 4-hydroxy-3H-pyridine-2,6-dione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-hydroxy-3H-pyridine-2,6-dione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 123475788 |
| Molecular Formula | C23H18N2O7 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-hydroxy-3H-pyridine-2,6-dione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1C=C(O)CC(=O)N1.O=C1Cc2oc(=O)cc(CCC#Cc3ccccc3)c2C(=O)N1 |
| InChI | InChI=1S/C18H13NO4.C5H5NO3/c20-15-11-14-17(18(22)19-15)13(10-16(21)23-14)9-5-4-8-12-6-2-1-3-7-12;7-3-1-4(8)6-5(9)2-3/h1-3,6-7,10H,5,9,11H2,(H,19,20,22);1,7H,2H2,(H,6,8,9) |
| InChIKey | AXZAOYGNDCWZPJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|