C30H22N2O8 — CID 161307205
4-but-3-ynyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 161307205) has the molecular formula C30H22N2O8 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-but-3-ynyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-but-3-ynyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 161307205 |
| Molecular Formula | C30H22N2O8 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 4-but-3-ynyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione;4-(4-phenylbut-3-ynyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | C#CCCc1cc(=O)oc2c1C(=O)NC(=O)C2.O=C1Cc2oc(=O)cc(CCC#Cc3ccccc3)c2C(=O)N1 |
| InChI | InChI=1S/C18H13NO4.C12H9NO4/c20-15-11-14-17(18(22)19-15)13(10-16(21)23-14)9-5-4-8-12-6-2-1-3-7-12;1-2-3-4-7-5-10(15)17-8-6-9(14)13-12(16)11(7)8/h1-3,6-7,10H,5,9,11H2,(H,19,20,22);1,5H,3-4,6H2,(H,13,14,16) |
| InChIKey | VIKJRGDKTFYKJY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|