C26H27F3N4O3S — CID 123227018
[[4-[[[hydroxy-[6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]amino]methyl]phenyl]-methylidene-oxo-λ6-sulfanyl]cyanamide (PubChem CID 123227018) has the molecular formula C26H27F3N4O3S and a molecular weight of 532.59 g/mol. Its IUPAC name is [[4-[[[hydroxy-[6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]amino]methyl]phenyl]-methylidene-oxo-λ6-sulfanyl]cyanamide.
| Compound Name | [[4-[[[hydroxy-[6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]amino]methyl]phenyl]-methylidene-oxo-λ6-sulfanyl]cyanamide |
|---|---|
| PubChem CID | 123227018 |
| Molecular Formula | C26H27F3N4O3S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [[4-[[[hydroxy-[6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]amino]methyl]phenyl]-methylidene-oxo-λ6-sulfanyl]cyanamide |
| SMILES | C=S(=O)(NC#N)c1ccc(CNC(O)c2cn(C(C)C)c(C)c(-c3cccc(C(F)(F)F)c3)c2=O)cc1 |
| InChI | InChI=1S/C26H27F3N4O3S/c1-16(2)33-14-22(24(34)23(17(33)3)19-6-5-7-20(12-19)26(27,28)29)25(35)31-13-18-8-10-21(11-9-18)37(4,36)32-15-30/h5-12,14,16,25,31,35H,4,13H2,1-3H3,(H,32,36) |
| InChIKey | NSDIPIYKATVZSY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|