C31H24F3N5O3S — CID 123685161
N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-[(4-cyanophenyl)methyl]-6-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 123685161) has the molecular formula C31H24F3N5O3S and a molecular weight of 603.63 g/mol. Its IUPAC name is N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-[(4-cyanophenyl)methyl]-6-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-[(4-cyanophenyl)methyl]-6-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123685161 |
| Molecular Formula | C31H24F3N5O3S |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-[(4-cyanophenyl)methyl]-6-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | C=S(=O)(NC#N)c1ccc(CNC(=O)c2cn(Cc3ccc(C#N)cc3)c(C)c(-c3cccc(C(F)(F)F)c3)c2=O)cc1 |
| InChI | InChI=1S/C31H24F3N5O3S/c1-20-28(24-4-3-5-25(14-24)31(32,33)34)29(40)27(18-39(20)17-23-8-6-21(15-35)7-9-23)30(41)37-16-22-10-12-26(13-11-22)43(2,42)38-19-36/h3-14,18H,2,16-17H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | CVFKKRJTKFFJPI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|