C21H20BrN5O4S — CID 123238656
5-bromo-N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-4-oxopyridine-3-carboxamide (PubChem CID 123238656) has the molecular formula C21H20BrN5O4S and a molecular weight of 518.39 g/mol. Its IUPAC name is 5-bromo-N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-4-oxopyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 123238656 |
| Molecular Formula | C21H20BrN5O4S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 5-bromo-N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]phenyl]methyl]-1-(3,4-dimethyl-1,2-oxazol-5-yl)-6-methyl-4-oxopyridine-3-carboxamide |
| SMILES | C=S(=O)(NC#N)c1ccc(CNC(=O)c2cn(-c3onc(C)c3C)c(C)c(Br)c2=O)cc1 |
| InChI | InChI=1S/C21H20BrN5O4S/c1-12-13(2)26-31-21(12)27-10-17(19(28)18(22)14(27)3)20(29)24-9-15-5-7-16(8-6-15)32(4,30)25-11-23/h5-8,10H,4,9H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | PZUTZPOXZOFKQD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|