C20H21BrN6O2S — CID 144576971
5-bromo-6-methyl-1-(1-methylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide (PubChem CID 144576971) has the molecular formula C20H21BrN6O2S and a molecular weight of 489.40 g/mol. Its IUPAC name is 5-bromo-6-methyl-1-(1-methylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide.
| Compound Name | 5-bromo-6-methyl-1-(1-methylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide |
|---|---|
| PubChem CID | 144576971 |
| Molecular Formula | C20H21BrN6O2S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 5-bromo-6-methyl-1-(1-methylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxopyridine-3-carboxamide;cyanamide |
| SMILES | CSc1ccc(CNC(=O)c2cn(-c3cnn(C)c3)c(C)c(Br)c2=O)cc1.N#CN |
| InChI | InChI=1S/C19H19BrN4O2S.CH2N2/c1-12-17(20)18(25)16(11-24(12)14-9-22-23(2)10-14)19(26)21-8-13-4-6-15(27-3)7-5-13;2-1-3/h4-7,9-11H,8H2,1-3H3,(H,21,26);2H2 |
| InChIKey | AFCRVSMITAXPSU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|