C26H24F4N4O3S — CID 123398999
N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]-3-fluorophenyl]methyl]-6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 123398999) has the molecular formula C26H24F4N4O3S and a molecular weight of 548.56 g/mol. Its IUPAC name is N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]-3-fluorophenyl]methyl]-6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]-3-fluorophenyl]methyl]-6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123398999 |
| Molecular Formula | C26H24F4N4O3S |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | N-[[4-[(cyanoamino)-methylidene-oxo-λ6-sulfanyl]-3-fluorophenyl]methyl]-6-methyl-4-oxo-1-propan-2-yl-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | C=S(=O)(NC#N)c1ccc(CNC(=O)c2cn(C(C)C)c(C)c(-c3cccc(C(F)(F)F)c3)c2=O)cc1F |
| InChI | InChI=1S/C26H24F4N4O3S/c1-15(2)34-13-20(24(35)23(16(34)3)18-6-5-7-19(11-18)26(28,29)30)25(36)32-12-17-8-9-22(21(27)10-17)38(4,37)33-14-31/h5-11,13,15H,4,12H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | AXWGTHCIJPTYEJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|