C27H47N — CID 123227307
(6E)-6-butan-2-ylidene-9-ethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine (PubChem CID 123227307) has the molecular formula C27H47N and a molecular weight of 385.68 g/mol. Its IUPAC name is (6E)-6-butan-2-ylidene-9-ethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine.
| Compound Name | (6E)-6-butan-2-ylidene-9-ethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine |
|---|---|
| PubChem CID | 123227307 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | (6E)-6-butan-2-ylidene-9-ethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine |
| SMILES | [H]/N=C(C(\CC=CCC)=C(/C)CC)/C(CC(=CC)CC)C(CC)CC(C)=CCC |
| InChI | InChI=1S/C27H47N/c1-9-15-16-18-25(22(8)11-3)27(28)26(20-23(12-4)13-5)24(14-6)19-21(7)17-10-2/h12,15-17,24,26,28H,9-11,13-14,18-20H2,1-8H3/b16-15?,21-17?,23-12?,25-22+,28-27+ |
| InChIKey | JHOBNXJHUIUBNC-DQFFQSRASA-N |
| XLogP | 9.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|