C40H44N2 — CID 123227487
4-N-(3-buta-1,3-dienylcyclohexa-2,4-dien-1-yl)-1-N-(3-but-3-enylcyclohexa-1,5-dien-1-yl)-1-N-(4-methylcyclohexa-2,4-dien-1-yl)-4-N-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 123227487) has the molecular formula C40H44N2 and a molecular weight of 552.81 g/mol. Its IUPAC name is 4-N-(3-buta-1,3-dienylcyclohexa-2,4-dien-1-yl)-1-N-(3-but-3-enylcyclohexa-1,5-dien-1-yl)-1-N-(4-methylcyclohexa-2,4-dien-1-yl)-4-N-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(3-buta-1,3-dienylcyclohexa-2,4-dien-1-yl)-1-N-(3-but-3-enylcyclohexa-1,5-dien-1-yl)-1-N-(4-methylcyclohexa-2,4-dien-1-yl)-4-N-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 123227487 |
| Molecular Formula | C40H44N2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 4-N-(3-buta-1,3-dienylcyclohexa-2,4-dien-1-yl)-1-N-(3-but-3-enylcyclohexa-1,5-dien-1-yl)-1-N-(4-methylcyclohexa-2,4-dien-1-yl)-4-N-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | C=CC=CC1=CC(N(c2ccc(C)cc2)c2ccc(N(C3=CC(CCC=C)CC=C3)C3C=CC(C)=CC3)cc2)CC=C1 |
| InChI | InChI=1S/C40H44N2/c1-5-7-11-33-13-9-15-39(29-33)41(35-21-17-31(3)18-22-35)37-25-27-38(28-26-37)42(36-23-19-32(4)20-24-36)40-16-10-14-34(30-40)12-8-6-2/h5-7,9-11,13,16-23,25-30,34,36,39H,1-2,8,12,14-15,24H2,3-4H3 |
| InChIKey | LRASQUGBJKRLLO-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|