C37H36N2 — CID 143684993
N-[[3-[4-[(1E)-buta-1,3-dienyl]-N-(4-phenylphenyl)anilino]cyclohexa-2,4-dien-1-yl]methyl]-N,4-dimethylaniline (PubChem CID 143684993) has the molecular formula C37H36N2 and a molecular weight of 508.71 g/mol. Its IUPAC name is N-[[3-[4-[(1E)-buta-1,3-dienyl]-N-(4-phenylphenyl)anilino]cyclohexa-2,4-dien-1-yl]methyl]-N,4-dimethylaniline.
| Compound Name | N-[[3-[4-[(1E)-buta-1,3-dienyl]-N-(4-phenylphenyl)anilino]cyclohexa-2,4-dien-1-yl]methyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 143684993 |
| Molecular Formula | C37H36N2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[[3-[4-[(1E)-buta-1,3-dienyl]-N-(4-phenylphenyl)anilino]cyclohexa-2,4-dien-1-yl]methyl]-N,4-dimethylaniline |
| SMILES | C=C/C=C/c1ccc(N(C2=CC(CN(C)c3ccc(C)cc3)CC=C2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H36N2/c1-4-5-10-30-17-23-35(24-18-30)39(36-25-19-33(20-26-36)32-12-7-6-8-13-32)37-14-9-11-31(27-37)28-38(3)34-21-15-29(2)16-22-34/h4-10,12-27,31H,1,11,28H2,2-3H3/b10-5+ |
| InChIKey | IIDPQHIVHPBLND-BJMVGYQFSA-N |
| XLogP | 9.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|