C29H31NO2 — CID 135128646
[4-[4-[(4-methylcyclohexa-2,4-dien-1-yl)-(4-methylcyclohexen-1-yl)amino]phenyl]phenyl] prop-2-enoate (PubChem CID 135128646) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is [4-[4-[(4-methylcyclohexa-2,4-dien-1-yl)-(4-methylcyclohexen-1-yl)amino]phenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-[(4-methylcyclohexa-2,4-dien-1-yl)-(4-methylcyclohexen-1-yl)amino]phenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 135128646 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [4-[4-[(4-methylcyclohexa-2,4-dien-1-yl)-(4-methylcyclohexen-1-yl)amino]phenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(N(C3=CCC(C)CC3)C3C=CC(C)=CC3)cc2)cc1 |
| InChI | InChI=1S/C29H31NO2/c1-4-29(31)32-28-19-11-24(12-20-28)23-9-17-27(18-10-23)30(25-13-5-21(2)6-14-25)26-15-7-22(3)8-16-26/h4-6,9-13,15,17-20,22,25H,1,7-8,14,16H2,2-3H3 |
| InChIKey | KTILPYHTSJWPOL-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|