About CID 123229942
CID 123229942 (PubChem CID 123229942) has the molecular formula C10H15BP+
and a molecular weight of 177.02 g/mol.
Molecular Properties
| Compound Name | CID 123229942 |
| PubChem CID | 123229942 |
| Molecular Formula | C10H15BP+ |
| Molecular Weight | 177.02 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | — |
| SMILES | [B][PH+](c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C10H15BP/c1-10(2,3)12(11)9-7-5-4-6-8-9/h4-8,12H,1-3H3/q+1 |
| InChIKey | KBEFNPKCESHCBI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.02 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 123229942 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123229942?
The IUPAC name of CID 123229942 (CID 123229942) is not available.
What is the SMILES notation for CID 123229942?
The canonical SMILES for CID 123229942 is [B][PH+](c1ccccc1)C(C)(C)C.
What is the InChIKey of CID 123229942?
The InChIKey is KBEFNPKCESHCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BP/c1-10(2,3)12(11)9-7-5-4-6-8-9/h4-8,12H,1-3H3/q+1.
What are the key properties of CID 123229942?
CID 123229942 has a molecular weight of 177.02 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123229942 is sourced from PubChem (CID 123229942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).