C17H22OP+ — CID 23415245
2,2-dimethylpropoxy(diphenyl)phosphanium (PubChem CID 23415245) has the molecular formula C17H22OP+ and a molecular weight of 273.34 g/mol. Its IUPAC name is 2,2-dimethylpropoxy(diphenyl)phosphanium.
| Compound Name | 2,2-dimethylpropoxy(diphenyl)phosphanium |
|---|---|
| PubChem CID | 23415245 |
| Molecular Formula | C17H22OP+ |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2,2-dimethylpropoxy(diphenyl)phosphanium |
| SMILES | CC(C)(C)CO[PH+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21OP/c1-17(2,3)14-18-19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3/p+1 |
| InChIKey | LXGUNQHBHYWEMC-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|