About N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine
N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine (PubChem CID 123230592) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine.
Molecular Properties
| Compound Name | N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine |
| PubChem CID | 123230592 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine |
| SMILES | C=C(C=CC)C(/N=C/C)=C(C)C |
| InChI | InChI=1S/C11H17N/c1-6-8-10(5)11(9(3)4)12-7-2/h6-8H,5H2,1-4H3/b8-6?,12-7+ |
| InChIKey | NSGPVBQXPXHFHM-SUXIFNBGSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine?
The IUPAC name of N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine (CID 123230592) is N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine.
What is the SMILES notation for N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine?
The canonical SMILES for N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine is C=C(C=CC)C(/N=C/C)=C(C)C.
What is the InChIKey of N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine?
The InChIKey is NSGPVBQXPXHFHM-SUXIFNBGSA-N. The full InChI is InChI=1S/C11H17N/c1-6-8-10(5)11(9(3)4)12-7-2/h6-8H,5H2,1-4H3/b8-6?,12-7+.
What are the key properties of N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine?
N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine has a molecular weight of 163.26 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-4-methylidenehepta-2,5-dien-3-yl)ethanimine is sourced from PubChem (CID 123230592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).