C16H24N2O6S — CID 123230755
N-[[4-hydroxy-5-(hydroxyamino)-6-methyl-3-oxooxan-2-yl]methyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 123230755) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[[4-hydroxy-5-(hydroxyamino)-6-methyl-3-oxooxan-2-yl]methyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[[4-hydroxy-5-(hydroxyamino)-6-methyl-3-oxooxan-2-yl]methyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 123230755 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[[4-hydroxy-5-(hydroxyamino)-6-methyl-3-oxooxan-2-yl]methyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC2OC(C)C(NO)C(O)C2=O)c(C)c1 |
| InChI | InChI=1S/C16H24N2O6S/c1-8-5-9(2)16(10(3)6-8)25(22,23)17-7-12-14(19)15(20)13(18-21)11(4)24-12/h5-6,11-13,15,17-18,20-21H,7H2,1-4H3 |
| InChIKey | IEHNGOKUHDQTQU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|