C23H30N2O4S — CID 123233656
N-methyl-1-(3-methylsulfonylpropyl)-2-oxo-N-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 123233656) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-methyl-1-(3-methylsulfonylpropyl)-2-oxo-N-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | N-methyl-1-(3-methylsulfonylpropyl)-2-oxo-N-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123233656 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-methyl-1-(3-methylsulfonylpropyl)-2-oxo-N-phenyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cc2c(n(CCCS(C)(=O)=O)c1=O)CCCCCC2)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-24(19-12-7-5-8-13-19)22(26)20-17-18-11-6-3-4-9-14-21(18)25(23(20)27)15-10-16-30(2,28)29/h5,7-8,12-13,17H,3-4,6,9-11,14-16H2,1-2H3 |
| InChIKey | PYPXCPWSBVENTP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |