C21H32N2O6S — CID 69493567
3-methyl-2-[[1-(3-methylsulfonylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoic acid (PubChem CID 69493567) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is 3-methyl-2-[[1-(3-methylsulfonylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[1-(3-methylsulfonylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 69493567 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 3-methyl-2-[[1-(3-methylsulfonylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)c1cc2c(n(CCCS(C)(=O)=O)c1=O)CCCCCC2)C(=O)O |
| InChI | InChI=1S/C21H32N2O6S/c1-14(2)18(21(26)27)22-19(24)16-13-15-9-6-4-5-7-10-17(15)23(20(16)25)11-8-12-30(3,28)29/h13-14,18H,4-12H2,1-3H3,(H,22,24)(H,26,27) |
| InChIKey | AUALAHPOXBJPNN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |