C26H34N2O4 — CID 69475366
methyl (2S)-3-methyl-2-[[1-[(4-methylphenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoate (PubChem CID 69475366) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[1-[(4-methylphenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[1-[(4-methylphenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 69475366 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[1-[(4-methylphenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cc2c(n(Cc3ccc(C)cc3)c1=O)CCCCCC2)C(C)C |
| InChI | InChI=1S/C26H34N2O4/c1-17(2)23(26(31)32-4)27-24(29)21-15-20-9-7-5-6-8-10-22(20)28(25(21)30)16-19-13-11-18(3)12-14-19/h11-15,17,23H,5-10,16H2,1-4H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | KTRFVXABEKCCTJ-QHCPKHFHSA-N |
| XLogP | 3.79 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |