C25H25FN2O5 — CID 67520097
2-[[1-[(4-fluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-(furan-2-yl)acetic acid (PubChem CID 67520097) has the molecular formula C25H25FN2O5 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-[[1-[(4-fluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-(furan-2-yl)acetic acid.
| Compound Name | 2-[[1-[(4-fluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-(furan-2-yl)acetic acid |
|---|---|
| PubChem CID | 67520097 |
| Molecular Formula | C25H25FN2O5 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[1-[(4-fluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-(furan-2-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccco1)c1cc2c(n(Cc3ccc(F)cc3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C25H25FN2O5/c26-18-11-9-16(10-12-18)15-28-20-7-4-2-1-3-6-17(20)14-19(24(28)30)23(29)27-22(25(31)32)21-8-5-13-33-21/h5,8-14,22H,1-4,6-7,15H2,(H,27,29)(H,31,32) |
| InChIKey | GZIABNOWXUMBQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |