C20H28N2O4 — CID 69474063
(2S)-3-methyl-2-[(2-oxo-1-prop-2-enyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]butanoic acid (PubChem CID 69474063) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-oxo-1-prop-2-enyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(2-oxo-1-prop-2-enyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 69474063 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S)-3-methyl-2-[(2-oxo-1-prop-2-enyl-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]butanoic acid |
| SMILES | C=CCn1c2c(cc(C(=O)N[C@H](C(=O)O)C(C)C)c1=O)CCCCCC2 |
| InChI | InChI=1S/C20H28N2O4/c1-4-11-22-16-10-8-6-5-7-9-14(16)12-15(19(22)24)18(23)21-17(13(2)3)20(25)26/h4,12-13,17H,1,5-11H2,2-3H3,(H,21,23)(H,25,26)/t17-/m0/s1 |
| InChIKey | ILNDGISVHTZPMX-KRWDZBQOSA-N |
| XLogP | 2.53 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|