C23H34N2O6 — CID 67520080
methyl 2-[[1-(1,3-dioxan-2-ylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-3-methylbutanoate (PubChem CID 67520080) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is methyl 2-[[1-(1,3-dioxan-2-ylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[1-(1,3-dioxan-2-ylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 67520080 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | methyl 2-[[1-(1,3-dioxan-2-ylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1cc2c(n(CC3OCCCO3)c1=O)CCCCCC2)C(C)C |
| InChI | InChI=1S/C23H34N2O6/c1-15(2)20(23(28)29-3)24-21(26)17-13-16-9-6-4-5-7-10-18(16)25(22(17)27)14-19-30-11-8-12-31-19/h13,15,19-20H,4-12,14H2,1-3H3,(H,24,26) |
| InChIKey | IKALZYNPGKIZDM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |