C25H31N3O5 — CID 69473163
(2R)-2-[[1-(3-acetamidopropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetic acid (PubChem CID 69473163) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (2R)-2-[[1-(3-acetamidopropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[1-(3-acetamidopropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 69473163 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (2R)-2-[[1-(3-acetamidopropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-phenylacetic acid |
| SMILES | CC(=O)NCCCn1c2c(cc(C(=O)N[C@@H](C(=O)O)c3ccccc3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C25H31N3O5/c1-17(29)26-14-9-15-28-21-13-8-3-2-5-12-19(21)16-20(24(28)31)23(30)27-22(25(32)33)18-10-6-4-7-11-18/h4,6-7,10-11,16,22H,2-3,5,8-9,12-15H2,1H3,(H,26,29)(H,27,30)(H,32,33)/t22-/m1/s1 |
| InChIKey | RKNSBSJBORDNRX-JOCHJYFZSA-N |
| XLogP | 2.59 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|