C19H18ClF2NO2 — CID 143720826
1-[(3,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl chloride (PubChem CID 143720826) has the molecular formula C19H18ClF2NO2 and a molecular weight of 365.81 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl chloride.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 143720826 |
| Molecular Formula | C19H18ClF2NO2 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2c(n(Cc3ccc(F)c(F)c3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C19H18ClF2NO2/c20-18(24)14-10-13-5-3-1-2-4-6-17(13)23(19(14)25)11-12-7-8-15(21)16(22)9-12/h7-10H,1-6,11H2 |
| InChIKey | MAQBZQXPGXLQLB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|