C19H32N4OS — CID 123235675
N-[3-(cyclopentylcarbamothioylamino)propyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide (PubChem CID 123235675) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is N-[3-(cyclopentylcarbamothioylamino)propyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[3-(cyclopentylcarbamothioylamino)propyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 123235675 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-[3-(cyclopentylcarbamothioylamino)propyl]-3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(NCCCNC(=S)NC1CCCC1)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C19H32N4OS/c24-19(23-13-10-15-6-1-2-7-16(15)14-23)21-12-5-11-20-18(25)22-17-8-3-4-9-17/h7,15,17H,1-6,8-14H2,(H,21,24)(H2,20,22,25) |
| InChIKey | JUXWSRPHOXGMQI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|