C19H31N3O2 — CID 66794822
1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-cycloheptylurea (PubChem CID 66794822) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-cycloheptylurea.
| Compound Name | 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-cycloheptylurea |
|---|---|
| PubChem CID | 66794822 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-cycloheptylurea |
| SMILES | O=C(NCC(=O)N1CCC2CCCC=C2C1)NC1CCCCCC1 |
| InChI | InChI=1S/C19H31N3O2/c23-18(22-12-11-15-7-5-6-8-16(15)14-22)13-20-19(24)21-17-9-3-1-2-4-10-17/h8,15,17H,1-7,9-14H2,(H2,20,21,24) |
| InChIKey | LQPIOKMGKHTVBA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|