C37H49N2O11S2+ — CID 123236280
[4-[3-[1-(5-carboxypentyl)-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium (PubChem CID 123236280) has the molecular formula C37H49N2O11S2+ and a molecular weight of 761.94 g/mol. Its IUPAC name is [4-[3-[1-(5-carboxypentyl)-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium.
| Compound Name | [4-[3-[1-(5-carboxypentyl)-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 123236280 |
| Molecular Formula | C37H49N2O11S2+ |
| Molecular Weight | 761.94 g/mol |
| Exact Mass | 761.28 |
| IUPAC Name | [4-[3-[1-(5-carboxypentyl)-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium |
| SMILES | CC/[N+](CCCS(=O)(=O)O)=c1/ccc2c(C=CC=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCOCCOC)ccoc-2c1 |
| InChI | InChI=1S/C37H48N2O11S2/c1-4-38(19-9-25-51(42,43)44)29-13-15-31-28(17-21-50-34(31)26-29)10-8-11-35-37(2,18-22-49-24-23-48-3)32-27-30(52(45,46)47)14-16-33(32)39(35)20-7-5-6-12-36(40)41/h8,10-11,13-17,21,26-27H,4-7,9,12,18-20,22-25H2,1-3H3,(H2-,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | NQOGKVNOGLBFKR-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 183.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|