C37H51N2O12S2+ — CID 144584056
[4-[(E,3E)-3-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium;methanol (PubChem CID 144584056) has the molecular formula C37H51N2O12S2+ and a molecular weight of 779.95 g/mol. Its IUPAC name is [4-[(E,3E)-3-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium;methanol.
| Compound Name | [4-[(E,3E)-3-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium;methanol |
|---|---|
| PubChem CID | 144584056 |
| Molecular Formula | C37H51N2O12S2+ |
| Molecular Weight | 779.95 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | [4-[(E,3E)-3-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium;methanol |
| SMILES | CO.COCC[N+](CCOC)=c1ccc2c(/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCCS(=O)(=O)O)ccoc-2c1 |
| InChI | InChI=1S/C36H46N2O11S2.CH4O/c1-36(17-8-24-50(41,42)43)31-26-29(51(44,45)46)13-15-32(31)38(18-6-4-5-11-35(39)40)34(36)10-7-9-27-16-21-49-33-25-28(12-14-30(27)33)37(19-22-47-2)20-23-48-3;1-2/h7,9-10,12-16,21,25-26H,4-6,8,11,17-20,22-24H2,1-3H3,(H2-,39,40,41,42,43,44,45,46);2H,1H3/p+1 |
| InChIKey | KFLWDLBJVIEVBL-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 204.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|