C35H44N2O10S2 — CID 144584067
3-[[4-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethylazaniumyl]propane-1-sulfonate (PubChem CID 144584067) has the molecular formula C35H44N2O10S2 and a molecular weight of 716.88 g/mol. Its IUPAC name is 3-[[4-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[[4-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 144584067 |
| Molecular Formula | C35H44N2O10S2 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 3-[[4-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethylazaniumyl]propane-1-sulfonate |
| SMILES | CC/[N+](CCCS(=O)(=O)[O-])=c1/ccc2c(/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCOC)ccoc-2c1 |
| InChI | InChI=1S/C35H44N2O10S2/c1-4-36(19-9-23-48(40,41)42)27-13-15-29-26(17-21-47-32(29)24-27)10-8-11-33-35(2,18-22-46-3)30-25-28(49(43,44)45)14-16-31(30)37(33)20-7-5-6-12-34(38)39/h8,10-11,13-17,21,24-25H,4-7,9,12,18-20,22-23H2,1-3H3,(H2-,38,39,40,41,42,43,44,45) |
| InChIKey | XUMQTWRTCGGRAY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 177.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|