C30H46NO2S+ — CID 123237228
2-(2-oxotridecyl)benzaldehyde;2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanethiol (PubChem CID 123237228) has the molecular formula C30H46NO2S+ and a molecular weight of 484.77 g/mol. Its IUPAC name is 2-(2-oxotridecyl)benzaldehyde;2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanethiol.
| Compound Name | 2-(2-oxotridecyl)benzaldehyde;2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanethiol |
|---|---|
| PubChem CID | 123237228 |
| Molecular Formula | C30H46NO2S+ |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-(2-oxotridecyl)benzaldehyde;2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanethiol |
| SMILES | CCCCCCCCCCCC(=O)Cc1ccccc1C=O.Cc1cc(C)[n+](CCS)c(C)c1 |
| InChI | InChI=1S/C20H30O2.C10H15NS/c1-2-3-4-5-6-7-8-9-10-15-20(22)16-18-13-11-12-14-19(18)17-21;1-8-6-9(2)11(4-5-12)10(3)7-8/h11-14,17H,2-10,15-16H2,1H3;6-7H,4-5H2,1-3H3/p+1 |
| InChIKey | QEGHGVHIKRETKV-UHFFFAOYSA-O |
| XLogP | 7.36 |
| TPSA | 38.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|