C7H8N2 — CID 123238167
6,7-dihydro-2H-cyclopenta[b]pyrazine (PubChem CID 123238167) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 6,7-dihydro-2H-cyclopenta[b]pyrazine.
| Compound Name | 6,7-dihydro-2H-cyclopenta[b]pyrazine |
|---|---|
| PubChem CID | 123238167 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 6,7-dihydro-2H-cyclopenta[b]pyrazine |
| SMILES | C1=NC2=CCCC2=NC1 |
| InChI | InChI=1S/C7H8N2/c1-2-6-7(3-1)9-5-4-8-6/h2,4H,1,3,5H2 |
| InChIKey | CKXJINLGEZQQKW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |