About 4-(cyclobuten-1-yl)-2,3-dihydroazete
4-(cyclobuten-1-yl)-2,3-dihydroazete (PubChem CID 88598916) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 4-(cyclobuten-1-yl)-2,3-dihydroazete.
Molecular Properties
| Compound Name | 4-(cyclobuten-1-yl)-2,3-dihydroazete |
| PubChem CID | 88598916 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 4-(cyclobuten-1-yl)-2,3-dihydroazete |
| SMILES | C1=C(C2=NCC2)CC1 |
| InChI | InChI=1S/C7H9N/c1-2-6(3-1)7-4-5-8-7/h2H,1,3-5H2 |
| InChIKey | QZLCUZJJKWXJBD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(cyclobuten-1-yl)-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclobuten-1-yl)-2,3-dihydroazete?
The IUPAC name of 4-(cyclobuten-1-yl)-2,3-dihydroazete (CID 88598916) is 4-(cyclobuten-1-yl)-2,3-dihydroazete.
What is the SMILES notation for 4-(cyclobuten-1-yl)-2,3-dihydroazete?
The canonical SMILES for 4-(cyclobuten-1-yl)-2,3-dihydroazete is C1=C(C2=NCC2)CC1.
What is the InChIKey of 4-(cyclobuten-1-yl)-2,3-dihydroazete?
The InChIKey is QZLCUZJJKWXJBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-2-6(3-1)7-4-5-8-7/h2H,1,3-5H2.
What are the key properties of 4-(cyclobuten-1-yl)-2,3-dihydroazete?
4-(cyclobuten-1-yl)-2,3-dihydroazete has a molecular weight of 107.16 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclobuten-1-yl)-2,3-dihydroazete is sourced from PubChem (CID 88598916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).