C7H9N — CID 88598916
4-(cyclobuten-1-yl)-2,3-dihydroazete (PubChem CID 88598916) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 4-(cyclobuten-1-yl)-2,3-dihydroazete.
| Compound Name | 4-(cyclobuten-1-yl)-2,3-dihydroazete |
|---|---|
| PubChem CID | 88598916 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 4-(cyclobuten-1-yl)-2,3-dihydroazete |
| SMILES | C1=C(C2=NCC2)CC1 |
| InChI | InChI=1S/C7H9N/c1-2-6(3-1)7-4-5-8-7/h2H,1,3-5H2 |
| InChIKey | QZLCUZJJKWXJBD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |