C17H15NY — CID 59738556
2,6-diphenyl-3,4-dihydropyridine;yttrium (PubChem CID 59738556) has the molecular formula C17H15NY and a molecular weight of 322.22 g/mol. Its IUPAC name is 2,6-diphenyl-3,4-dihydropyridine;yttrium.
| Compound Name | 2,6-diphenyl-3,4-dihydropyridine;yttrium |
|---|---|
| PubChem CID | 59738556 |
| Molecular Formula | C17H15NY |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2,6-diphenyl-3,4-dihydropyridine;yttrium |
| SMILES | C1=C(c2ccccc2)N=C(c2ccccc2)CC1.[Y] |
| InChI | InChI=1S/C17H15N.Y/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15;/h1-6,8-12H,7,13H2; |
| InChIKey | LCVWUUADKPWXSE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |