C14H13N — CID 10081370
3-phenyl-5,6-dihydro-4H-indole (PubChem CID 10081370) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-phenyl-5,6-dihydro-4H-indole.
| Compound Name | 3-phenyl-5,6-dihydro-4H-indole |
|---|---|
| PubChem CID | 10081370 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-phenyl-5,6-dihydro-4H-indole |
| SMILES | C1=NC2=CCCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C14H13N/c1-2-6-11(7-3-1)13-10-15-14-9-5-4-8-12(13)14/h1-3,6-7,9-10H,4-5,8H2 |
| InChIKey | KIUATBLRQMOZBS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |