C21H18S — CID 15731491
2,4-diphenyl-6,7-dihydro-5H-thiochromene (PubChem CID 15731491) has the molecular formula C21H18S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2,4-diphenyl-6,7-dihydro-5H-thiochromene.
| Compound Name | 2,4-diphenyl-6,7-dihydro-5H-thiochromene |
|---|---|
| PubChem CID | 15731491 |
| Molecular Formula | C21H18S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2,4-diphenyl-6,7-dihydro-5H-thiochromene |
| SMILES | C1=C2SC(c3ccccc3)=CC(c3ccccc3)=C2CCC1 |
| InChI | InChI=1S/C21H18S/c1-3-9-16(10-4-1)19-15-21(17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20/h1-6,9-12,14-15H,7-8,13H2 |
| InChIKey | UYHUJZHKZJLGAN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |