C27H19NOS — CID 162715481
3-(2,6-diphenylthiopyran-4-ylidene)-5-phenyl-1H-pyrrol-2-one (PubChem CID 162715481) has the molecular formula C27H19NOS and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-(2,6-diphenylthiopyran-4-ylidene)-5-phenyl-1H-pyrrol-2-one.
| Compound Name | 3-(2,6-diphenylthiopyran-4-ylidene)-5-phenyl-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 162715481 |
| Molecular Formula | C27H19NOS |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-(2,6-diphenylthiopyran-4-ylidene)-5-phenyl-1H-pyrrol-2-one |
| SMILES | O=C1NC(c2ccccc2)=CC1=C1C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C27H19NOS/c29-27-23(18-24(28-27)19-10-4-1-5-11-19)22-16-25(20-12-6-2-7-13-20)30-26(17-22)21-14-8-3-9-15-21/h1-18H,(H,28,29) |
| InChIKey | ZSYSNXOEFRGHBI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|