C10H7NO2 — CID 13165116
5-phenyl-1H-pyrrole-2,3-dione (PubChem CID 13165116) has the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. Its IUPAC name is 5-phenyl-1H-pyrrole-2,3-dione.
| Compound Name | 5-phenyl-1H-pyrrole-2,3-dione |
|---|---|
| PubChem CID | 13165116 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5-phenyl-1H-pyrrole-2,3-dione |
| SMILES | O=C1C=C(c2ccccc2)NC1=O |
| InChI | InChI=1S/C10H7NO2/c12-9-6-8(11-10(9)13)7-4-2-1-3-5-7/h1-6H,(H,11,12,13) |
| InChIKey | GHURLMDZQKAWAS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|