C18H13NO2 — CID 146457509
2-anilino-5-phenylcyclohexa-2,5-diene-1,4-dione (PubChem CID 146457509) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-anilino-5-phenylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-anilino-5-phenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 146457509 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-anilino-5-phenylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(c2ccccc2)C(=O)C=C1Nc1ccccc1 |
| InChI | InChI=1S/C18H13NO2/c20-17-12-16(19-14-9-5-2-6-10-14)18(21)11-15(17)13-7-3-1-4-8-13/h1-12,19H |
| InChIKey | ZQLZHJXUTAHJOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|