C18H12O4 — CID 158662900
cyclohexa-2,5-diene-1,4-dione;2-phenylcyclohexa-2,5-diene-1,4-dione (PubChem CID 158662900) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2-phenylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2-phenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 158662900 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2-phenylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(c2ccccc2)=C1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C12H8O2.C6H4O2/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9;7-5-1-2-6(8)4-3-5/h1-8H;1-4H |
| InChIKey | ICZDHVYVAWKNKO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|