C18H10O3 — CID 67717361
2-dibenzofuran-1-ylcyclohexa-2,5-diene-1,4-dione (PubChem CID 67717361) has the molecular formula C18H10O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-dibenzofuran-1-ylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-dibenzofuran-1-ylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 67717361 |
| Molecular Formula | C18H10O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-dibenzofuran-1-ylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(c2cccc3oc4ccccc4c23)=C1 |
| InChI | InChI=1S/C18H10O3/c19-11-8-9-15(20)14(10-11)12-5-3-7-17-18(12)13-4-1-2-6-16(13)21-17/h1-10H |
| InChIKey | LCGPRJUDVGGSSC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|