About dibenzofuran;fluoren-1-one
dibenzofuran;fluoren-1-one (PubChem CID 175397829) has the molecular formula C25H16O2
and a molecular weight of 348.40 g/mol. Its IUPAC name is dibenzofuran;fluoren-1-one.
Molecular Properties
| Compound Name | dibenzofuran;fluoren-1-one |
| PubChem CID | 175397829 |
| Molecular Formula | C25H16O2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | dibenzofuran;fluoren-1-one |
| SMILES | O=C1C=CC=C2C1=Cc1ccccc12.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C13H8O.C12H8O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H;1-8H |
| InChIKey | VBGWLEFIOXXXJL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzofuran;fluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran;fluoren-1-one?
The IUPAC name of dibenzofuran;fluoren-1-one (CID 175397829) is dibenzofuran;fluoren-1-one.
What is the SMILES notation for dibenzofuran;fluoren-1-one?
The canonical SMILES for dibenzofuran;fluoren-1-one is O=C1C=CC=C2C1=Cc1ccccc12.c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;fluoren-1-one?
The InChIKey is VBGWLEFIOXXXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C12H8O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H;1-8H.
What are the key properties of dibenzofuran;fluoren-1-one?
dibenzofuran;fluoren-1-one has a molecular weight of 348.40 g/mol, XLogP of 6.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;fluoren-1-one is sourced from PubChem (CID 175397829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).