C19H22O3 — CID 174955276
2,3-dimethylbutane-2,3-diol;fluoren-1-one (PubChem CID 174955276) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;fluoren-1-one.
| Compound Name | 2,3-dimethylbutane-2,3-diol;fluoren-1-one |
|---|---|
| PubChem CID | 174955276 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;fluoren-1-one |
| SMILES | CC(C)(O)C(C)(C)O.O=C1C=CC=C2C1=Cc1ccccc12 |
| InChI | InChI=1S/C13H8O.C6H14O2/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-5(2,7)6(3,4)8/h1-8H;7-8H,1-4H3 |
| InChIKey | BRNXSLHDJUSLMR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |