About fluoren-1-one;iodosylbenzene
fluoren-1-one;iodosylbenzene (PubChem CID 175965867) has the molecular formula C19H13IO2
and a molecular weight of 400.22 g/mol. Its IUPAC name is fluoren-1-one;iodosylbenzene.
Molecular Properties
| Compound Name | fluoren-1-one;iodosylbenzene |
| PubChem CID | 175965867 |
| Molecular Formula | C19H13IO2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | fluoren-1-one;iodosylbenzene |
| SMILES | O=C1C=CC=C2C1=Cc1ccccc12.O=Ic1ccccc1 |
| InChI | InChI=1S/C13H8O.C6H5IO/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;8-7-6-4-2-1-3-5-6/h1-8H;1-5H |
| InChIKey | CBDUDMOIYHLEPX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze fluoren-1-one;iodosylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-1-one;iodosylbenzene?
The IUPAC name of fluoren-1-one;iodosylbenzene (CID 175965867) is fluoren-1-one;iodosylbenzene.
What is the SMILES notation for fluoren-1-one;iodosylbenzene?
The canonical SMILES for fluoren-1-one;iodosylbenzene is O=C1C=CC=C2C1=Cc1ccccc12.O=Ic1ccccc1.
What is the InChIKey of fluoren-1-one;iodosylbenzene?
The InChIKey is CBDUDMOIYHLEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C6H5IO/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;8-7-6-4-2-1-3-5-6/h1-8H;1-5H.
What are the key properties of fluoren-1-one;iodosylbenzene?
fluoren-1-one;iodosylbenzene has a molecular weight of 400.22 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-1-one;iodosylbenzene is sourced from PubChem (CID 175965867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).