C20H14O3 — CID 175130283
2-phenanthren-1-ylcyclohexa-2,5-diene-1,4-dione;hydrate (PubChem CID 175130283) has the molecular formula C20H14O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-phenanthren-1-ylcyclohexa-2,5-diene-1,4-dione;hydrate.
| Compound Name | 2-phenanthren-1-ylcyclohexa-2,5-diene-1,4-dione;hydrate |
|---|---|
| PubChem CID | 175130283 |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-phenanthren-1-ylcyclohexa-2,5-diene-1,4-dione;hydrate |
| SMILES | O.O=C1C=CC(=O)C(c2cccc3c2ccc2ccccc23)=C1 |
| InChI | InChI=1S/C20H12O2.H2O/c21-14-9-11-20(22)19(12-14)17-7-3-6-16-15-5-2-1-4-13(15)8-10-18(16)17;/h1-12H;1H2 |
| InChIKey | KOAASDZBTPWGHV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|