C40H27O3P — CID 15253825
2-(4-oxo-2,5-diphenylcyclohexa-2,5-dien-1-ylidene)-4-(triphenyl-lambda5-phosphanylidene)cyclobutane-1,3-dione (PubChem CID 15253825) has the molecular formula C40H27O3P and a molecular weight of 586.63 g/mol. Its IUPAC name is 2-(4-oxo-2,5-diphenylcyclohexa-2,5-dien-1-ylidene)-4-(triphenyl-lambda5-phosphanylidene)cyclobutane-1,3-dione.
| Compound Name | 2-(4-oxo-2,5-diphenylcyclohexa-2,5-dien-1-ylidene)-4-(triphenyl-lambda5-phosphanylidene)cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 15253825 |
| Molecular Formula | C40H27O3P |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 2-(4-oxo-2,5-diphenylcyclohexa-2,5-dien-1-ylidene)-4-(triphenyl-lambda5-phosphanylidene)cyclobutane-1,3-dione |
| SMILES | O=C1C=C(c2ccccc2)C(=C2C(=O)C(=P(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C40H27O3P/c41-36-27-33(28-16-6-1-7-17-28)35(26-34(36)29-18-8-2-9-19-29)37-38(42)40(39(37)43)44(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-27H |
| InChIKey | PCBNMJDTEOOFEL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|