C42H30O4P2 — CID 132604508
4,6-bis(triphenyl-λ5-phosphanylidene)cyclohexane-1,2,3,5-tetrone (PubChem CID 132604508) has the molecular formula C42H30O4P2 and a molecular weight of 660.65 g/mol. Its IUPAC name is 4,6-bis(triphenyl-λ5-phosphanylidene)cyclohexane-1,2,3,5-tetrone.
| Compound Name | 4,6-bis(triphenyl-λ5-phosphanylidene)cyclohexane-1,2,3,5-tetrone |
|---|---|
| PubChem CID | 132604508 |
| Molecular Formula | C42H30O4P2 |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 4,6-bis(triphenyl-λ5-phosphanylidene)cyclohexane-1,2,3,5-tetrone |
| SMILES | O=C1C(=O)C(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C42H30O4P2/c43-37-38(44)41(47(31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33)40(46)42(39(37)45)48(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | YBIAOIPNKXUMLE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|