C23H20NO2P — CID 15858594
(5S)-5-methyl-3-(triphenyl-lambda5-phosphanylidene)pyrrolidine-2,4-dione (PubChem CID 15858594) has the molecular formula C23H20NO2P and a molecular weight of 373.39 g/mol. Its IUPAC name is (5S)-5-methyl-3-(triphenyl-lambda5-phosphanylidene)pyrrolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-3-(triphenyl-lambda5-phosphanylidene)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 15858594 |
| Molecular Formula | C23H20NO2P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (5S)-5-methyl-3-(triphenyl-lambda5-phosphanylidene)pyrrolidine-2,4-dione |
| SMILES | C[C@@H]1NC(=O)C(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H20NO2P/c1-17-21(25)22(23(26)24-17)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | BAJGELPBIKWJHE-KRWDZBQOSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|