C30H26NO2P — CID 101071045
3-methyl-1-(4-methylphenyl)-4-(triphenyl-λ5-phosphanylidene)pyrrolidine-2,5-dione (PubChem CID 101071045) has the molecular formula C30H26NO2P and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)-4-(triphenyl-λ5-phosphanylidene)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-(4-methylphenyl)-4-(triphenyl-λ5-phosphanylidene)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 101071045 |
| Molecular Formula | C30H26NO2P |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)-4-(triphenyl-λ5-phosphanylidene)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(=P(c3ccccc3)(c3ccccc3)c3ccccc3)C(C)C2=O)cc1 |
| InChI | InChI=1S/C30H26NO2P/c1-22-18-20-24(21-19-22)31-29(32)23(2)28(30(31)33)34(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-21,23H,1-2H3 |
| InChIKey | MHNRZBNZJILPCB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|